C29H38O — CID 145049447
but-1-ene;5-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene;1-propan-2-ylnaphthalene (PubChem CID 145049447) has the molecular formula C29H38O and a molecular weight of 402.62 g/mol. Its IUPAC name is but-1-ene;5-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene;1-propan-2-ylnaphthalene.
| Compound Name | but-1-ene;5-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene;1-propan-2-ylnaphthalene |
|---|---|
| PubChem CID | 145049447 |
| Molecular Formula | C29H38O |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | but-1-ene;5-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene;1-propan-2-ylnaphthalene |
| SMILES | C=CCC.CC(C)c1cccc2ccccc12.COc1cccc2c1CCC(C)C2 |
| InChI | InChI=1S/C13H14.C12H16O.C4H8/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-9-6-7-11-10(8-9)4-3-5-12(11)13-2;1-3-4-2/h3-10H,1-2H3;3-5,9H,6-8H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | XIXBMZGLSQYYNW-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|