About 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene
2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 177322497) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene.
Analyze 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene?
The IUPAC name of 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene (CID 177322497) is 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene.
What is the SMILES notation for 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene?
The canonical SMILES for 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene is C=Cc1ccc(C=C)c2c1CC2.
What is the InChIKey of 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene?
The InChIKey is QOYGIBLBEJWCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12/c1-3-9-5-6-10(4-2)12-8-7-11(9)12/h3-6H,1-2,7-8H2.
What are the key properties of 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene?
2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene has a molecular weight of 156.23 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(ethenyl)bicyclo[4.2.0]octa-1,3,5-triene is sourced from PubChem (CID 177322497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).