C13H18O — CID 153201426
4-methoxy-5,6,7,8,9,10-hexahydrobenzo[8]annulene (PubChem CID 153201426) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-methoxy-5,6,7,8,9,10-hexahydrobenzo[8]annulene.
| Compound Name | 4-methoxy-5,6,7,8,9,10-hexahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 153201426 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-methoxy-5,6,7,8,9,10-hexahydrobenzo[8]annulene |
| SMILES | COc1cccc2c1CCCCCC2 |
| InChI | InChI=1S/C13H18O/c1-14-13-10-6-8-11-7-4-2-3-5-9-12(11)13/h6,8,10H,2-5,7,9H2,1H3 |
| InChIKey | WJZLCIGHYVRMPH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |