C16H16O2 — CID 12651974
1,8-dimethoxy-9,10-dihydroanthracene (PubChem CID 12651974) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1,8-dimethoxy-9,10-dihydroanthracene.
| Compound Name | 1,8-dimethoxy-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 12651974 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1,8-dimethoxy-9,10-dihydroanthracene |
| SMILES | COc1cccc2c1Cc1c(cccc1OC)C2 |
| InChI | InChI=1S/C16H16O2/c1-17-15-7-3-5-11-9-12-6-4-8-16(18-2)14(12)10-13(11)15/h3-8H,9-10H2,1-2H3 |
| InChIKey | OCAFEWLZRWMLMT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |