C9H12N2O — CID 125426011
4-methoxy-1,3-dihydroisoindol-2-amine (PubChem CID 125426011) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-methoxy-1,3-dihydroisoindol-2-amine.
| Compound Name | 4-methoxy-1,3-dihydroisoindol-2-amine |
|---|---|
| PubChem CID | 125426011 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-methoxy-1,3-dihydroisoindol-2-amine |
| SMILES | COc1cccc2c1CN(N)C2 |
| InChI | InChI=1S/C9H12N2O/c1-12-9-4-2-3-7-5-11(10)6-8(7)9/h2-4H,5-6,10H2,1H3 |
| InChIKey | RFKJFNZDNRWWIP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|