C11H13NO2 — CID 20754713
1-(4-methoxy-1,3-dihydroisoindol-2-yl)ethanone (PubChem CID 20754713) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(4-methoxy-1,3-dihydroisoindol-2-yl)ethanone.
| Compound Name | 1-(4-methoxy-1,3-dihydroisoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 20754713 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1-(4-methoxy-1,3-dihydroisoindol-2-yl)ethanone |
| SMILES | COc1cccc2c1CN(C(C)=O)C2 |
| InChI | InChI=1S/C11H13NO2/c1-8(13)12-6-9-4-3-5-11(14-2)10(9)7-12/h3-5H,6-7H2,1-2H3 |
| InChIKey | KHFRUTYZFDMDRF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |