C13H11F6NO3 — CID 138619078
1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxy-1,3-dihydroisoindole-2-carboxylate (PubChem CID 138619078) has the molecular formula C13H11F6NO3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxy-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxy-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 138619078 |
| Molecular Formula | C13H11F6NO3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methoxy-1,3-dihydroisoindole-2-carboxylate |
| SMILES | COc1cccc2c1CN(C(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C13H11F6NO3/c1-22-9-4-2-3-7-5-20(6-8(7)9)11(21)23-10(12(14,15)16)13(17,18)19/h2-4,10H,5-6H2,1H3 |
| InChIKey | FCWGFMFJJJCIOV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |