C12H14FNO2 — CID 143812546
ethene;methyl 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 143812546) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is ethene;methyl 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | ethene;methyl 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 143812546 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | ethene;methyl 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=C.COC(=O)N1Cc2cccc(F)c2C1 |
| InChI | InChI=1S/C10H10FNO2.C2H4/c1-14-10(13)12-5-7-3-2-4-9(11)8(7)6-12;1-2/h2-4H,5-6H2,1H3;1-2H2 |
| InChIKey | FMRFECINQOZVSX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|