C13H18FN — CID 143037628
ethane;4-fluoro-2-prop-1-en-2-yl-1,3-dihydroisoindole (PubChem CID 143037628) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is ethane;4-fluoro-2-prop-1-en-2-yl-1,3-dihydroisoindole.
| Compound Name | ethane;4-fluoro-2-prop-1-en-2-yl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 143037628 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | ethane;4-fluoro-2-prop-1-en-2-yl-1,3-dihydroisoindole |
| SMILES | C=C(C)N1Cc2cccc(F)c2C1.CC |
| InChI | InChI=1S/C11H12FN.C2H6/c1-8(2)13-6-9-4-3-5-11(12)10(9)7-13;1-2/h3-5H,1,6-7H2,2H3;1-2H3 |
| InChIKey | KSZGPBGZXBDTEB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |