C13H11FN2OS2 — CID 166512163
1-(4-fluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone (PubChem CID 166512163) has the molecular formula C13H11FN2OS2 and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(4-fluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-(4-fluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 166512163 |
| Molecular Formula | C13H11FN2OS2 |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-(4-fluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nccs1)N1Cc2cccc(F)c2C1 |
| InChI | InChI=1S/C13H11FN2OS2/c14-11-3-1-2-9-6-16(7-10(9)11)12(17)8-19-13-15-4-5-18-13/h1-5H,6-8H2 |
| InChIKey | GQOCPXWKTGQVEX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|