C13H13NO2S2 — CID 61219522
1-(2-ethoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone (PubChem CID 61219522) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-(2-ethoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 61219522 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 1-(2-ethoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
| SMILES | CCOc1ccccc1C(=O)CSc1nccs1 |
| InChI | InChI=1S/C13H13NO2S2/c1-2-16-12-6-4-3-5-10(12)11(15)9-18-13-14-7-8-17-13/h3-8H,2,9H2,1H3 |
| InChIKey | WARRFQKCYSLGLS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|