C15H17N3O2S2 — CID 60530030
N-propan-2-yl-2-[[2-(1,3-thiazol-2-ylsulfanyl)acetyl]amino]benzamide (PubChem CID 60530030) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-propan-2-yl-2-[[2-(1,3-thiazol-2-ylsulfanyl)acetyl]amino]benzamide.
| Compound Name | N-propan-2-yl-2-[[2-(1,3-thiazol-2-ylsulfanyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 60530030 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-propan-2-yl-2-[[2-(1,3-thiazol-2-ylsulfanyl)acetyl]amino]benzamide |
| SMILES | CC(C)NC(=O)c1ccccc1NC(=O)CSc1nccs1 |
| InChI | InChI=1S/C15H17N3O2S2/c1-10(2)17-14(20)11-5-3-4-6-12(11)18-13(19)9-22-15-16-7-8-21-15/h3-8,10H,9H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | YCWCHXUBSHTTFT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|