C22H23N5O4S2 — CID 55602504
ethyl N-[5-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55602504) has the molecular formula C22H23N5O4S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl N-[5-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55602504 |
| Molecular Formula | C22H23N5O4S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | ethyl N-[5-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCC(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)s1 |
| InChI | InChI=1S/C22H23N5O4S2/c1-3-31-21(30)25-20-26-27-22(33-20)32-13-18(28)24-17-12-8-7-11-16(17)19(29)23-14(2)15-9-5-4-6-10-15/h4-12,14H,3,13H2,1-2H3,(H,23,29)(H,24,28)(H,25,26,30) |
| InChIKey | ABABMLUCBVWHLX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|