C20H18FN5O4S2 — CID 55640334
ethyl N-[5-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55640334) has the molecular formula C20H18FN5O4S2 and a molecular weight of 475.53 g/mol. Its IUPAC name is ethyl N-[5-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55640334 |
| Molecular Formula | C20H18FN5O4S2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | ethyl N-[5-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCC(=O)Nc2ccccc2C(=O)Nc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H18FN5O4S2/c1-2-30-19(29)24-18-25-26-20(32-18)31-11-16(27)23-15-6-4-3-5-14(15)17(28)22-13-9-7-12(21)8-10-13/h3-10H,2,11H2,1H3,(H,22,28)(H,23,27)(H,24,25,29) |
| InChIKey | SGPOCDWADCXAAN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|