C14H15IN4O3S2 — CID 55504479
ethyl N-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55504479) has the molecular formula C14H15IN4O3S2 and a molecular weight of 478.34 g/mol. Its IUPAC name is ethyl N-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55504479 |
| Molecular Formula | C14H15IN4O3S2 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | ethyl N-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCC(=O)Nc2ccc(I)cc2C)s1 |
| InChI | InChI=1S/C14H15IN4O3S2/c1-3-22-13(21)17-12-18-19-14(24-12)23-7-11(20)16-10-5-4-9(15)6-8(10)2/h4-6H,3,7H2,1-2H3,(H,16,20)(H,17,18,21) |
| InChIKey | SKYHULRSFQZLIC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|