C15H17N5OS3 — CID 8911043
[3-methyl-4-[[2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]phenyl] thiocyanate (PubChem CID 8911043) has the molecular formula C15H17N5OS3 and a molecular weight of 379.54 g/mol. Its IUPAC name is [3-methyl-4-[[2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]phenyl] thiocyanate.
| Compound Name | [3-methyl-4-[[2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 8911043 |
| Molecular Formula | C15H17N5OS3 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [3-methyl-4-[[2-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]phenyl] thiocyanate |
| SMILES | CCCNc1nnc(SCC(=O)Nc2ccc(SC#N)cc2C)s1 |
| InChI | InChI=1S/C15H17N5OS3/c1-3-6-17-14-19-20-15(24-14)22-8-13(21)18-12-5-4-11(23-9-16)7-10(12)2/h4-5,7H,3,6,8H2,1-2H3,(H,17,19)(H,18,21) |
| InChIKey | BBGNTTJLLWUGLB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|