C20H16N2OS2 — CID 7793156
[3-methyl-4-[(2-naphthalen-2-ylsulfanylacetyl)amino]phenyl] thiocyanate (PubChem CID 7793156) has the molecular formula C20H16N2OS2 and a molecular weight of 364.50 g/mol. Its IUPAC name is [3-methyl-4-[(2-naphthalen-2-ylsulfanylacetyl)amino]phenyl] thiocyanate.
| Compound Name | [3-methyl-4-[(2-naphthalen-2-ylsulfanylacetyl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 7793156 |
| Molecular Formula | C20H16N2OS2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [3-methyl-4-[(2-naphthalen-2-ylsulfanylacetyl)amino]phenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16N2OS2/c1-14-10-17(25-13-21)8-9-19(14)22-20(23)12-24-18-7-6-15-4-2-3-5-16(15)11-18/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | JGHRSANGDAJJHG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|