C18H16N6OS2 — CID 7647104
[3-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]phenyl] thiocyanate (PubChem CID 7647104) has the molecular formula C18H16N6OS2 and a molecular weight of 396.50 g/mol. Its IUPAC name is [3-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]phenyl] thiocyanate.
| Compound Name | [3-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 7647104 |
| Molecular Formula | C18H16N6OS2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [3-methyl-4-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]phenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)CSc1nnnn1-c1ccccc1C |
| InChI | InChI=1S/C18H16N6OS2/c1-12-5-3-4-6-16(12)24-18(21-22-23-24)26-10-17(25)20-15-8-7-14(27-11-19)9-13(15)2/h3-9H,10H2,1-2H3,(H,20,25) |
| InChIKey | XERFIVSNSCPEPT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|