C17H14N6OS2 — CID 7762426
[3-methyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]phenyl] thiocyanate (PubChem CID 7762426) has the molecular formula C17H14N6OS2 and a molecular weight of 382.47 g/mol. Its IUPAC name is [3-methyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]phenyl] thiocyanate.
| Compound Name | [3-methyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 7762426 |
| Molecular Formula | C17H14N6OS2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [3-methyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]phenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C17H14N6OS2/c1-12-9-14(26-11-18)7-8-15(12)19-16(24)10-25-17-20-21-22-23(17)13-5-3-2-4-6-13/h2-9H,10H2,1H3,(H,19,24) |
| InChIKey | HGPOQOPLOSYAOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|