C18H15N5OS3 — CID 7999955
[4-[[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate (PubChem CID 7999955) has the molecular formula C18H15N5OS3 and a molecular weight of 413.55 g/mol. Its IUPAC name is [4-[[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate.
| Compound Name | [4-[[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate |
|---|---|
| PubChem CID | 7999955 |
| Molecular Formula | C18H15N5OS3 |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [4-[[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)CSc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C18H15N5OS3/c1-12-9-14(26-11-19)7-8-15(12)21-16(24)10-25-18-23-22-17(27-18)20-13-5-3-2-4-6-13/h2-9H,10H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | DWIMSPZOGVKAMZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|