C16H13ClN6O3S — CID 4674077
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 4674077) has the molecular formula C16H13ClN6O3S and a molecular weight of 404.84 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4674077 |
| Molecular Formula | C16H13ClN6O3S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN6O3S/c1-10-8-13(23(25)26)6-7-14(10)18-15(24)9-27-16-19-20-21-22(16)12-4-2-11(17)3-5-12/h2-8H,9H2,1H3,(H,18,24) |
| InChIKey | NKKUZUMQZQXAST-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|