C19H19ClN6O3S — CID 3138541
2-[[5-[(4-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 3138541) has the molecular formula C19H19ClN6O3S and a molecular weight of 446.92 g/mol. Its IUPAC name is 2-[[5-[(4-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(4-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3138541 |
| Molecular Formula | C19H19ClN6O3S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-[[5-[(4-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(CNc2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C19H19ClN6O3S/c1-12-9-15(26(28)29)7-8-16(12)22-18(27)11-30-19-24-23-17(25(19)2)10-21-14-5-3-13(20)4-6-14/h3-9,21H,10-11H2,1-2H3,(H,22,27) |
| InChIKey | HLCMVWQKYQYFTJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|