C17H15ClN2OS2 — CID 8580271
[4-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate (PubChem CID 8580271) has the molecular formula C17H15ClN2OS2 and a molecular weight of 362.91 g/mol. Its IUPAC name is [4-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate.
| Compound Name | [4-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate |
|---|---|
| PubChem CID | 8580271 |
| Molecular Formula | C17H15ClN2OS2 |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [4-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-methylphenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)CSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2OS2/c1-12-8-15(23-11-19)6-7-16(12)20-17(21)10-22-9-13-2-4-14(18)5-3-13/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | WQBXEBXEOVENRH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|