C23H22ClNOS2 — CID 27042111
2-[(3-chlorophenyl)methylsulfanyl]-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]acetamide (PubChem CID 27042111) has the molecular formula C23H22ClNOS2 and a molecular weight of 428.02 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 27042111 |
| Molecular Formula | C23H22ClNOS2 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]acetamide |
| SMILES | Cc1cc(CSc2ccccc2)ccc1NC(=O)CSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClNOS2/c1-17-12-19(15-28-21-8-3-2-4-9-21)10-11-22(17)25-23(26)16-27-14-18-6-5-7-20(24)13-18/h2-13H,14-16H2,1H3,(H,25,26) |
| InChIKey | CUQCJPPEVYWVOO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |