C15H13Cl2NO2S — CID 56581526
N-(5-chloro-2-hydroxyphenyl)-2-[(3-chlorophenyl)methylsulfanyl]acetamide (PubChem CID 56581526) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-[(3-chlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-[(3-chlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 56581526 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-[(3-chlorophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1cccc(Cl)c1)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H13Cl2NO2S/c16-11-3-1-2-10(6-11)8-21-9-15(20)18-13-7-12(17)4-5-14(13)19/h1-7,19H,8-9H2,(H,18,20) |
| InChIKey | LJFUYXNYPAMVTD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|