C17H15ClNO3S- — CID 9322946
3-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]-4-methylbenzoate (PubChem CID 9322946) has the molecular formula C17H15ClNO3S- and a molecular weight of 348.83 g/mol. Its IUPAC name is 3-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]-4-methylbenzoate.
| Compound Name | 3-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 9322946 |
| Molecular Formula | C17H15ClNO3S- |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1NC(=O)CSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-11-5-6-13(17(21)22)8-15(11)19-16(20)10-23-9-12-3-2-4-14(18)7-12/h2-8H,9-10H2,1H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | KBSVBVWRWFBMKB-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |