C24H24ClNO2S — CID 99949605
(2S)-2-(3-chlorophenoxy)-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]butanamide (PubChem CID 99949605) has the molecular formula C24H24ClNO2S and a molecular weight of 425.98 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]butanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 99949605 |
| Molecular Formula | C24H24ClNO2S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-[2-methyl-4-(phenylsulfanylmethyl)phenyl]butanamide |
| SMILES | CC[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc(CSc2ccccc2)cc1C |
| InChI | InChI=1S/C24H24ClNO2S/c1-3-23(28-20-9-7-8-19(25)15-20)24(27)26-22-13-12-18(14-17(22)2)16-29-21-10-5-4-6-11-21/h4-15,23H,3,16H2,1-2H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | AZKVLQYEZDCIEW-QHCPKHFHSA-N |
| XLogP | 6.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |