C17H21ClN4O2S2 — CID 2782283
N-(4-butyl-2-methylphenyl)-2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2782283) has the molecular formula C17H21ClN4O2S2 and a molecular weight of 412.97 g/mol. Its IUPAC name is N-(4-butyl-2-methylphenyl)-2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-butyl-2-methylphenyl)-2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2782283 |
| Molecular Formula | C17H21ClN4O2S2 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(4-butyl-2-methylphenyl)-2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2nnc(NC(=O)CCl)s2)c(C)c1 |
| InChI | InChI=1S/C17H21ClN4O2S2/c1-3-4-5-12-6-7-13(11(2)8-12)19-15(24)10-25-17-22-21-16(26-17)20-14(23)9-18/h6-8H,3-5,9-10H2,1-2H3,(H,19,24)(H,20,21,23) |
| InChIKey | WFPKNBAHOXFVOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|