C15H15ClN4O4S2 — CID 50741146
ethyl 4-[[2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 50741146) has the molecular formula C15H15ClN4O4S2 and a molecular weight of 414.90 g/mol. Its IUPAC name is ethyl 4-[[2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 50741146 |
| Molecular Formula | C15H15ClN4O4S2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | ethyl 4-[[2-[[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nnc(NC(=O)CCl)s2)cc1 |
| InChI | InChI=1S/C15H15ClN4O4S2/c1-2-24-13(23)9-3-5-10(6-4-9)17-12(22)8-25-15-20-19-14(26-15)18-11(21)7-16/h3-6H,2,7-8H2,1H3,(H,17,22)(H,18,19,21) |
| InChIKey | JIFCZMKSSZCZAA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|