C16H15N5O5S3 — CID 55640066
ethyl N-[5-[2-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55640066) has the molecular formula C16H15N5O5S3 and a molecular weight of 453.53 g/mol. Its IUPAC name is ethyl N-[5-[2-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55640066 |
| Molecular Formula | C16H15N5O5S3 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | ethyl N-[5-[2-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCC(=O)Nc2nc3cc4c(cc3s2)OCCO4)s1 |
| InChI | InChI=1S/C16H15N5O5S3/c1-2-24-15(23)19-14-20-21-16(29-14)27-7-12(22)18-13-17-8-5-9-10(6-11(8)28-13)26-4-3-25-9/h5-6H,2-4,7H2,1H3,(H,17,18,22)(H,19,20,23) |
| InChIKey | SVHHLUAPCCJXND-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|