C17H21N5O6S3 — CID 55504730
ethyl N-[5-[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55504730) has the molecular formula C17H21N5O6S3 and a molecular weight of 487.59 g/mol. Its IUPAC name is ethyl N-[5-[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55504730 |
| Molecular Formula | C17H21N5O6S3 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | ethyl N-[5-[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C17H21N5O6S3/c1-2-28-16(24)19-15-20-21-17(30-15)29-11-14(23)18-12-4-3-5-13(10-12)31(25,26)22-6-8-27-9-7-22/h3-5,10H,2,6-9,11H2,1H3,(H,18,23)(H,19,20,24) |
| InChIKey | IVFXCDBJBNNNQT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|