C17H22N4O6S3 — CID 55602471
ethyl N-[5-[2-(4-morpholin-4-ylsulfonylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55602471) has the molecular formula C17H22N4O6S3 and a molecular weight of 474.59 g/mol. Its IUPAC name is ethyl N-[5-[2-(4-morpholin-4-ylsulfonylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[2-(4-morpholin-4-ylsulfonylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55602471 |
| Molecular Formula | C17H22N4O6S3 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | ethyl N-[5-[2-(4-morpholin-4-ylsulfonylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCCOc2ccc(S(=O)(=O)N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C17H22N4O6S3/c1-2-26-16(22)18-15-19-20-17(29-15)28-12-11-27-13-3-5-14(6-4-13)30(23,24)21-7-9-25-10-8-21/h3-6H,2,7-12H2,1H3,(H,18,19,22) |
| InChIKey | WWRSJLZYWFJORA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|