C22H28N2O6S2 — CID 42998392
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 42998392) has the molecular formula C22H28N2O6S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42998392 |
| Molecular Formula | C22H28N2O6S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | CCOc1ccc(OCCSCC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C22H28N2O6S2/c1-2-29-19-6-8-20(9-7-19)30-14-15-31-17-22(25)23-18-4-3-5-21(16-18)32(26,27)24-10-12-28-13-11-24/h3-9,16H,2,10-15,17H2,1H3,(H,23,25) |
| InChIKey | PESWLFHBGBCFLP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|