C20H25N5O6S3 — CID 44956778
ethyl 2-[[2-[[5-[(4-piperidin-1-ylsulfonylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate (PubChem CID 44956778) has the molecular formula C20H25N5O6S3 and a molecular weight of 527.65 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(4-piperidin-1-ylsulfonylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[[5-[(4-piperidin-1-ylsulfonylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 44956778 |
| Molecular Formula | C20H25N5O6S3 |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | ethyl 2-[[2-[[5-[(4-piperidin-1-ylsulfonylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CSc1nnc(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C20H25N5O6S3/c1-2-31-17(27)12-21-16(26)13-32-20-24-23-19(33-20)22-18(28)14-6-8-15(9-7-14)34(29,30)25-10-4-3-5-11-25/h6-9H,2-5,10-13H2,1H3,(H,21,26)(H,22,23,28) |
| InChIKey | RDKBAWLAUDEQRD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|