C23H23N5O7S3 — CID 44956601
N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 44956601) has the molecular formula C23H23N5O7S3 and a molecular weight of 577.67 g/mol. Its IUPAC name is N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 44956601 |
| Molecular Formula | C23H23N5O7S3 |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)s1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H23N5O7S3/c29-20(24-16-3-6-18-19(13-16)35-12-11-34-18)14-36-23-27-26-22(37-23)25-21(30)15-1-4-17(5-2-15)38(31,32)28-7-9-33-10-8-28/h1-6,13H,7-12,14H2,(H,24,29)(H,25,26,30) |
| InChIKey | IPYZKZGGHSFKOH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 149.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|