C19H15BrN4O4S2 — CID 40832968
4-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 40832968) has the molecular formula C19H15BrN4O4S2 and a molecular weight of 507.39 g/mol. Its IUPAC name is 4-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 40832968 |
| Molecular Formula | C19H15BrN4O4S2 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | 4-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc(Br)cc2)s1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H15BrN4O4S2/c20-12-3-1-11(2-4-12)17(26)22-18-23-24-19(30-18)29-10-16(25)21-13-5-6-14-15(9-13)28-8-7-27-14/h1-6,9H,7-8,10H2,(H,21,25)(H,22,23,26) |
| InChIKey | JLOZIISLWQIQGZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|