About methyl 7-fluoro-2,3-dihydroindole-1-carboxylate
methyl 7-fluoro-2,3-dihydroindole-1-carboxylate (PubChem CID 110725158) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is methyl 7-fluoro-2,3-dihydroindole-1-carboxylate.
Molecular Properties
| Compound Name | methyl 7-fluoro-2,3-dihydroindole-1-carboxylate |
| PubChem CID | 110725158 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | methyl 7-fluoro-2,3-dihydroindole-1-carboxylate |
| SMILES | COC(=O)N1CCc2cccc(F)c21 |
| InChI | InChI=1S/C10H10FNO2/c1-14-10(13)12-6-5-7-3-2-4-8(11)9(7)12/h2-4H,5-6H2,1H3 |
| InChIKey | DIDLSLLWLGSODC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 7-fluoro-2,3-dihydroindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-fluoro-2,3-dihydroindole-1-carboxylate?
The IUPAC name of methyl 7-fluoro-2,3-dihydroindole-1-carboxylate (CID 110725158) is methyl 7-fluoro-2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for methyl 7-fluoro-2,3-dihydroindole-1-carboxylate?
The canonical SMILES for methyl 7-fluoro-2,3-dihydroindole-1-carboxylate is COC(=O)N1CCc2cccc(F)c21.
What is the InChIKey of methyl 7-fluoro-2,3-dihydroindole-1-carboxylate?
The InChIKey is DIDLSLLWLGSODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c1-14-10(13)12-6-5-7-3-2-4-8(11)9(7)12/h2-4H,5-6H2,1H3.
What are the key properties of methyl 7-fluoro-2,3-dihydroindole-1-carboxylate?
methyl 7-fluoro-2,3-dihydroindole-1-carboxylate has a molecular weight of 195.19 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-fluoro-2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 110725158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).