C18H18FNO2 — CID 110743982
2-(4-ethoxyphenyl)-1-(7-fluoro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 110743982) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-(7-fluoro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(4-ethoxyphenyl)-1-(7-fluoro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 110743982 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-(7-fluoro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCc3cccc(F)c32)cc1 |
| InChI | InChI=1S/C18H18FNO2/c1-2-22-15-8-6-13(7-9-15)12-17(21)20-11-10-14-4-3-5-16(19)18(14)20/h3-9H,2,10-12H2,1H3 |
| InChIKey | HJLSHHPMXDLJRQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |