C28H29FN2O3 — CID 89062978
3-[4-[[1-[2-[4-(dimethylamino)phenyl]acetyl]-2,3-dihydroindol-7-yl]methoxy]-2-fluorophenyl]propanal (PubChem CID 89062978) has the molecular formula C28H29FN2O3 and a molecular weight of 460.55 g/mol. Its IUPAC name is 3-[4-[[1-[2-[4-(dimethylamino)phenyl]acetyl]-2,3-dihydroindol-7-yl]methoxy]-2-fluorophenyl]propanal.
| Compound Name | 3-[4-[[1-[2-[4-(dimethylamino)phenyl]acetyl]-2,3-dihydroindol-7-yl]methoxy]-2-fluorophenyl]propanal |
|---|---|
| PubChem CID | 89062978 |
| Molecular Formula | C28H29FN2O3 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-[4-[[1-[2-[4-(dimethylamino)phenyl]acetyl]-2,3-dihydroindol-7-yl]methoxy]-2-fluorophenyl]propanal |
| SMILES | CN(C)c1ccc(CC(=O)N2CCc3cccc(COc4ccc(CCC=O)c(F)c4)c32)cc1 |
| InChI | InChI=1S/C28H29FN2O3/c1-30(2)24-11-8-20(9-12-24)17-27(33)31-15-14-22-5-3-6-23(28(22)31)19-34-25-13-10-21(7-4-16-32)26(29)18-25/h3,5-6,8-13,16,18H,4,7,14-15,17,19H2,1-2H3 |
| InChIKey | WXKGBMOUBYSCHR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|