C13H10BrF6NO2 — CID 138619167
1,1,1,3,3,3-hexafluoropropan-2-yl 8-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 138619167) has the molecular formula C13H10BrF6NO2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 8-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 8-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 138619167 |
| Molecular Formula | C13H10BrF6NO2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 8-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCc2cccc(Br)c2C1 |
| InChI | InChI=1S/C13H10BrF6NO2/c14-9-3-1-2-7-4-5-21(6-8(7)9)11(22)23-10(12(15,16)17)13(18,19)20/h1-3,10H,4-6H2 |
| InChIKey | SIIOBSPURGIYQS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |