About 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate
1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 138619212) has the molecular formula C13H14BrF2NO2
and a molecular weight of 334.16 g/mol. Its IUPAC name is 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| PubChem CID | 138619212 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OC(CF)CF)N1CCc2c(Br)cccc2C1 |
| InChI | InChI=1S/C13H14BrF2NO2/c14-12-3-1-2-9-8-17(5-4-11(9)12)13(18)19-10(6-15)7-16/h1-3,10H,4-8H2 |
| InChIKey | MNSCKAVMZBTGFJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 138619212) is 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate is O=C(OC(CF)CF)N1CCc2c(Br)cccc2C1.
What is the InChIKey of 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is MNSCKAVMZBTGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrF2NO2/c14-12-3-1-2-9-8-17(5-4-11(9)12)13(18)19-10(6-15)7-16/h1-3,10H,4-8H2.
What are the key properties of 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate?
1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 334.16 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoropropan-2-yl 5-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 138619212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).