C13H18O — CID 177395557
5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene (PubChem CID 177395557) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene.
| Compound Name | 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 177395557 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
| SMILES | COc1cccc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C13H18O/c1-13(2)8-7-10-5-4-6-12(14-3)11(10)9-13/h4-6H,7-9H2,1-3H3 |
| InChIKey | VUWOOSYKZRQVSI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |