About 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene
5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene (PubChem CID 177395557) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
| PubChem CID | 177395557 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
| SMILES | COc1cccc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C13H18O/c1-13(2)8-7-10-5-4-6-12(14-3)11(10)9-13/h4-6H,7-9H2,1-3H3 |
| InChIKey | VUWOOSYKZRQVSI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
The IUPAC name of 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene (CID 177395557) is 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene.
What is the SMILES notation for 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
The canonical SMILES for 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene is COc1cccc2c1CC(C)(C)CC2.
What is the InChIKey of 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
The InChIKey is VUWOOSYKZRQVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-13(2)8-7-10-5-4-6-12(14-3)11(10)9-13/h4-6H,7-9H2,1-3H3.
What are the key properties of 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene has a molecular weight of 190.29 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,3-dimethyl-2,4-dihydro-1H-naphthalene is sourced from PubChem (CID 177395557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).