About 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid
5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 21350616) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
Analyze 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The IUPAC name of 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid (CID 21350616) is 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
What is the SMILES notation for 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The canonical SMILES for 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid is COc1cccc2c1CCC(C)(C(=O)O)C2.
What is the InChIKey of 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The InChIKey is PWEGGGPGDKUXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-13(12(14)15)7-6-10-9(8-13)4-3-5-11(10)16-2/h3-5H,6-8H2,1-2H3,(H,14,15).
What are the key properties of 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid has a molecular weight of 220.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-methyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid is sourced from PubChem (CID 21350616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).