About 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene
3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene (PubChem CID 84718384) has the molecular formula C11H13FO
and a molecular weight of 180.22 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene.
Molecular Properties
| Compound Name | 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene |
| PubChem CID | 84718384 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene |
| SMILES | COc1cccc2c1C(C)(F)CC2 |
| InChI | InChI=1S/C11H13FO/c1-11(12)7-6-8-4-3-5-9(13-2)10(8)11/h3-5H,6-7H2,1-2H3 |
| InChIKey | JGMDSUYPKATVPV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene?
The IUPAC name of 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene (CID 84718384) is 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene.
What is the SMILES notation for 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene?
The canonical SMILES for 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene is COc1cccc2c1C(C)(F)CC2.
What is the InChIKey of 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene?
The InChIKey is JGMDSUYPKATVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO/c1-11(12)7-6-8-4-3-5-9(13-2)10(8)11/h3-5H,6-7H2,1-2H3.
What are the key properties of 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene?
3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene has a molecular weight of 180.22 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-methoxy-3-methyl-1,2-dihydroindene is sourced from PubChem (CID 84718384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).