C11H14FNO2 — CID 116811435
3-(2,6-dimethoxyphenyl)-3-fluoroazetidine (PubChem CID 116811435) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)-3-fluoroazetidine.
| Compound Name | 3-(2,6-dimethoxyphenyl)-3-fluoroazetidine |
|---|---|
| PubChem CID | 116811435 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)-3-fluoroazetidine |
| SMILES | COc1cccc(OC)c1C1(F)CNC1 |
| InChI | InChI=1S/C11H14FNO2/c1-14-8-4-3-5-9(15-2)10(8)11(12)6-13-7-11/h3-5,13H,6-7H2,1-2H3 |
| InChIKey | FFROZPNRINJHMZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |