C11H13NO — CID 72698777
4-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane] (PubChem CID 72698777) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane].
| Compound Name | 4-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 72698777 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane] |
| SMILES | COc1cccc2c1C1(CC1)CN2 |
| InChI | InChI=1S/C11H13NO/c1-13-9-4-2-3-8-10(9)11(5-6-11)7-12-8/h2-4,12H,5-7H2,1H3 |
| InChIKey | MYUFPLMFHJOOLV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |