About 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]
7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] (PubChem CID 138594581) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine].
Molecular Properties
| Compound Name | 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] |
| PubChem CID | 138594581 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] |
| SMILES | COc1cccc2c1NCC21CCNCC1 |
| InChI | InChI=1S/C13H18N2O/c1-16-11-4-2-3-10-12(11)15-9-13(10)5-7-14-8-6-13/h2-4,14-15H,5-9H2,1H3 |
| InChIKey | QZZUOGDCEPZLEO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]?
The IUPAC name of 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] (CID 138594581) is 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine].
What is the SMILES notation for 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]?
The canonical SMILES for 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] is COc1cccc2c1NCC21CCNCC1.
What is the InChIKey of 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]?
The InChIKey is QZZUOGDCEPZLEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-16-11-4-2-3-10-12(11)15-9-13(10)5-7-14-8-6-13/h2-4,14-15H,5-9H2,1H3.
What are the key properties of 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]?
7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] has a molecular weight of 218.30 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] is sourced from PubChem (CID 138594581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).