C13H18N2O — CID 138594581
7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] (PubChem CID 138594581) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine].
| Compound Name | 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] |
|---|---|
| PubChem CID | 138594581 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine] |
| SMILES | COc1cccc2c1NCC21CCNCC1 |
| InChI | InChI=1S/C13H18N2O/c1-16-11-4-2-3-10-12(11)15-9-13(10)5-7-14-8-6-13/h2-4,14-15H,5-9H2,1H3 |
| InChIKey | QZZUOGDCEPZLEO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |