C11H13FN2 — CID 83830130
7-fluorospiro[1,2-dihydroindole-3,3'-pyrrolidine] (PubChem CID 83830130) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 7-fluorospiro[1,2-dihydroindole-3,3'-pyrrolidine].
| Compound Name | 7-fluorospiro[1,2-dihydroindole-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 83830130 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 7-fluorospiro[1,2-dihydroindole-3,3'-pyrrolidine] |
| SMILES | Fc1cccc2c1NCC21CCNC1 |
| InChI | InChI=1S/C11H13FN2/c12-9-3-1-2-8-10(9)14-7-11(8)4-5-13-6-11/h1-3,13-14H,4-7H2 |
| InChIKey | JNRBSAINEKFYPO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |