C12H13FN2O2 — CID 117103664
8-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one (PubChem CID 117103664) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 8-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one.
| Compound Name | 8-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 117103664 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 8-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
| SMILES | O=C1Nc2c(F)cccc2C2(CCCNC2)O1 |
| InChI | InChI=1S/C12H13FN2O2/c13-9-4-1-3-8-10(9)15-11(16)17-12(8)5-2-6-14-7-12/h1,3-4,14H,2,5-7H2,(H,15,16) |
| InChIKey | SXNDQILZCBJXSU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |