C13H16FN — CID 97290270
(3S)-7-fluorospiro[1,2-dihydroindene-3,3'-piperidine] (PubChem CID 97290270) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is (3S)-7-fluorospiro[1,2-dihydroindene-3,3'-piperidine].
| Compound Name | (3S)-7-fluorospiro[1,2-dihydroindene-3,3'-piperidine] |
|---|---|
| PubChem CID | 97290270 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (3S)-7-fluorospiro[1,2-dihydroindene-3,3'-piperidine] |
| SMILES | Fc1cccc2c1CC[C@]21CCCNC1 |
| InChI | InChI=1S/C13H16FN/c14-12-4-1-3-11-10(12)5-7-13(11)6-2-8-15-9-13/h1,3-4,15H,2,5-9H2/t13-/m0/s1 |
| InChIKey | OASOAUKDUNYFHD-ZDUSSCGKSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |